EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26N2O5 |
| Net Charge | 0 |
| Average Mass | 386.448 |
| Monoisotopic Mass | 386.18417 |
| SMILES | COc1ccc(CC(C)(C)NC[C@H](O)c2cc(O)cc3c2OCC(=O)N3)cc1 |
| InChI | InChI=1S/C21H26N2O5/c1-21(2,10-13-4-6-15(27-3)7-5-13)22-11-18(25)16-8-14(24)9-17-20(16)28-12-19(26)23-17/h4-9,18,22,24-25H,10-12H2,1-3H3,(H,23,26)/t18-/m0/s1 |
| InChIKey | COUYJEVMBVSIHV-SFHVURJKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. |
| Applications: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| olodaterol (CHEBI:82700) has role bronchodilator agent (CHEBI:35523) |
| olodaterol (CHEBI:82700) has role β-adrenergic agonist (CHEBI:35522) |
| olodaterol (CHEBI:82700) is a aromatic ether (CHEBI:35618) |
| olodaterol (CHEBI:82700) is a benzoxazine (CHEBI:46969) |
| olodaterol (CHEBI:82700) is a phenols (CHEBI:33853) |
| olodaterol (CHEBI:82700) is a secondary alcohol (CHEBI:35681) |
| olodaterol (CHEBI:82700) is a secondary amino compound (CHEBI:50995) |
| olodaterol (CHEBI:82700) is conjugate base of olodaterol(1+) (CHEBI:83312) |
| Incoming Relation(s) |
| olodaterol(1+) (CHEBI:83312) is conjugate acid of olodaterol (CHEBI:82700) |
| IUPAC Name |
|---|
| 6-hydroxy-8-[(1R)-1-hydroxy-2-{[1-(4-methoxyphenyl)-2-methylpropan-2-yl]amino}ethyl]-2H-1,4-benzoxazin-3(4H)-one |
| INN | Source |
|---|---|
| olodaterol | KEGG DRUG |
| Synonym | Source |
|---|---|
| BI 1744 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D10145 | KEGG DRUG |
| Olodaterol | Wikipedia |
| 4814 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12431799 | Reaxys |
| CAS:868049-49-4 | ChemIDplus |
| Citations |
|---|