EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:82969 - γ-Glu-Tyr
| Formula | C14H18N2O6 |
| Net Charge | 0 |
| Average Mass | 310.306 |
| Monoisotopic Mass | 310.11649 |
| SMILES | N[C@@H](CCC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C14H18N2O6/c15-10(13(19)20)5-6-12(18)16-11(14(21)22)7-8-1-3-9(17)4-2-8/h1-4,10-11,17H,5-7,15H2,(H,16,18)(H,19,20)(H,21,22)/t10-,11-/m0/s1 |
| InChIKey | VVLXCWVSSLFQDS-QWRGUYRKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (21886157) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-Glu-Tyr (CHEBI:82969) has functional parent L-glutamic acid (CHEBI:16015) |
| γ-Glu-Tyr (CHEBI:82969) has functional parent L-tyrosine (CHEBI:17895) |
| γ-Glu-Tyr (CHEBI:82969) has role human metabolite (CHEBI:77746) |
| γ-Glu-Tyr (CHEBI:82969) is a dicarboxylic acid (CHEBI:35692) |
| γ-Glu-Tyr (CHEBI:82969) is a dipeptide (CHEBI:46761) |
| γ-Glu-Tyr (CHEBI:82969) is a phenols (CHEBI:33853) |
| γ-Glu-Tyr (CHEBI:82969) is a primary amino compound (CHEBI:50994) |
| γ-Glu-Tyr (CHEBI:82969) is a secondary carboxamide (CHEBI:140325) |
| γ-Glu-Tyr (CHEBI:82969) is conjugate acid of γ-Glu-Tyr(1−) (CHEBI:133722) |
| Incoming Relation(s) |
| γ-Glu-Tyr(1−) (CHEBI:133722) is conjugate base of γ-Glu-Tyr (CHEBI:82969) |
| IUPAC Name |
|---|
| L-γ-glutamyl-L-tyrosine |
| Synonym | Source |
|---|---|
| γ-glutamyltyrosine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0011741 | HMDB |
| Citations |
|---|