EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H17N2O6 |
| Net Charge | -1 |
| Average Mass | 309.298 |
| Monoisotopic Mass | 309.10921 |
| SMILES | [NH3+][C@@H](CCC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C14H18N2O6/c15-10(13(19)20)5-6-12(18)16-11(14(21)22)7-8-1-3-9(17)4-2-8/h1-4,10-11,17H,5-7,15H2,(H,16,18)(H,19,20)(H,21,22)/p-1/t10-,11-/m0/s1 |
| InChIKey | VVLXCWVSSLFQDS-QWRGUYRKSA-M |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-Glu-Tyr(1−) (CHEBI:133722) has role human metabolite (CHEBI:77746) |
| γ-Glu-Tyr(1−) (CHEBI:133722) is a peptide anion (CHEBI:60334) |
| γ-Glu-Tyr(1−) (CHEBI:133722) is conjugate base of γ-Glu-Tyr (CHEBI:82969) |
| Incoming Relation(s) |
| γ-Glu-Tyr (CHEBI:82969) is conjugate acid of γ-Glu-Tyr(1−) (CHEBI:133722) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-5-{[(1S)-1-carboxylato-2-(4-hydroxyphenyl)ethyl]amino}-5-oxopentanoate |
| Synonyms | Source |
|---|---|
| γ-glutamyltyrosinate | ChEBI |
| L-γ-Glu-L-Tyr | ChEBI |
| L-γ-glutamyl-L-tyrosinate | ChEBI |