EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16N2O6 |
| Net Charge | 0 |
| Average Mass | 248.235 |
| Monoisotopic Mass | 248.10084 |
| SMILES | C[C@@H](O)[C@H](NC(=O)CC[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C9H16N2O6/c1-4(12)7(9(16)17)11-6(13)3-2-5(10)8(14)15/h4-5,7,12H,2-3,10H2,1H3,(H,11,13)(H,14,15)(H,16,17)/t4-,5+,7+/m1/s1 |
| InChIKey | GWNXFCYUJXASDX-ZDLURKLDSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-γ-Glu-L-Thr (CHEBI:133747) has role human metabolite (CHEBI:77746) |
| L-γ-Glu-L-Thr (CHEBI:133747) is a γ-glutamylthreonine (CHEBI:82968) |
| L-γ-Glu-L-Thr (CHEBI:133747) is conjugate acid of L-γ-Glu-L-Thr(1−) (CHEBI:133717) |
| Incoming Relation(s) |
| L-γ-Glu-L-Thr(1−) (CHEBI:133717) is conjugate base of L-γ-Glu-L-Thr (CHEBI:133747) |
| IUPAC Name |
|---|
| L-γ-glutamyl-L-threonine |
| Synonyms | Source |
|---|---|
| L-γ-Glu-L-Thr | ChEBI |
| (2S)-2-amino-5-{[(1S,2R)-1-carboxy-2-hydroxypropyl]amino}-5-oxopentanoic acid | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6866882 | Reaxys |