EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18N2O5S |
| Net Charge | 0 |
| Average Mass | 278.330 |
| Monoisotopic Mass | 278.09364 |
| SMILES | CSCC[C@H](NC(=O)CC[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C10H18N2O5S/c1-18-5-4-7(10(16)17)12-8(13)3-2-6(11)9(14)15/h6-7H,2-5,11H2,1H3,(H,12,13)(H,14,15)(H,16,17)/t6-,7-/m0/s1 |
| InChIKey | RQNSKRXMANOPQY-BQBZGAKWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (21886157) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-Glu-Met (CHEBI:82965) has functional parent L-glutamic acid (CHEBI:16015) |
| γ-Glu-Met (CHEBI:82965) has functional parent L-methionine (CHEBI:16643) |
| γ-Glu-Met (CHEBI:82965) has role human metabolite (CHEBI:77746) |
| γ-Glu-Met (CHEBI:82965) is a dipeptide (CHEBI:46761) |
| γ-Glu-Met (CHEBI:82965) is conjugate acid of γ-Glu-Met(1−) (CHEBI:133690) |
| Incoming Relation(s) |
| γ-Glu-Met(1−) (CHEBI:133690) is conjugate base of γ-Glu-Met (CHEBI:82965) |
| IUPAC Name |
|---|
| L-γ-glutamyl-L-methionine |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029155 | HMDB |
| Citations |
|---|