EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H15N3O2S |
| Net Charge | 0 |
| Average Mass | 229.305 |
| Monoisotopic Mass | 229.08850 |
| SMILES | CN(C)[C@@H](Cc1c(S)ncn1C)C(=O)O |
| InChI | InChI=1S/C9H15N3O2S/c1-11(2)7(9(13)14)4-6-8(15)10-5-12(6)3/h5,7,15H,4H2,1-3H3,(H,13,14)/t7-/m0/s1 |
| InChIKey | ONAWDGXCZMVYMN-ZETCQYMHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Strongylocentrotus purpuratus (ncbitaxon:7668) | - | PubMed (3651433) |
| Roles Classification |
|---|
| Chemical Roles: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ovothiol C (CHEBI:83415) has role antioxidant (CHEBI:22586) |
| ovothiol C (CHEBI:83415) has role marine metabolite (CHEBI:76507) |
| ovothiol C (CHEBI:83415) has role radical scavenger (CHEBI:48578) |
| ovothiol C (CHEBI:83415) is a L-histidine derivative (CHEBI:84076) |
| ovothiol C (CHEBI:83415) is a aryl thiol (CHEBI:82711) |
| ovothiol C (CHEBI:83415) is tautomer of ovothiol C zwitterion (CHEBI:82725) |
| Incoming Relation(s) |
| ovothiol C zwitterion (CHEBI:82725) is tautomer of ovothiol C (CHEBI:83415) |
| IUPAC Name |
|---|
| N,N,3-trimethyl-5-sulfanyl-L-histidine |
| Synonyms | Source |
|---|---|
| 1-Methyl-alpha(N), alpha(N)-dimethyl-4-thiohistidine | ChemIDplus |
| L-ovothiol C | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4689691 | Reaxys |
| Reaxys:7750792 | Reaxys |
| CAS:105496-34-2 | ChemIDplus |
| Citations |
|---|