EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H13N3O2S |
| Net Charge | 0 |
| Average Mass | 215.278 |
| Monoisotopic Mass | 215.07285 |
| SMILES | CN[C@@H](Cc1c(S)ncn1C)C(=O)O |
| InChI | InChI=1S/C8H13N3O2S/c1-9-5(8(12)13)3-6-7(14)10-4-11(6)2/h4-5,9,14H,3H2,1-2H3,(H,12,13)/t5-/m0/s1 |
| InChIKey | VBMIRSPJYVMQOI-YFKPBYRVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chlamys hastata (ncbitaxon:50342) | - | PubMed (3651433) |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Role: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ovothiol B (CHEBI:83413) has role antioxidant (CHEBI:22586) |
| ovothiol B (CHEBI:83413) has role marine metabolite (CHEBI:76507) |
| ovothiol B (CHEBI:83413) has role radical scavenger (CHEBI:48578) |
| ovothiol B (CHEBI:83413) is a L-histidine derivative (CHEBI:84076) |
| ovothiol B (CHEBI:83413) is a aryl thiol (CHEBI:82711) |
| ovothiol B (CHEBI:83413) is tautomer of ovothiol B zwitterion (CHEBI:82724) |
| Incoming Relation(s) |
| ovothiol B zwitterion (CHEBI:82724) is tautomer of ovothiol B (CHEBI:83413) |
| IUPAC Name |
|---|
| N,3-dimethyl-5-sulfanyl-L-histidine |
| Synonym | Source |
|---|---|
| L-ovothiol B | ChEBI |
| Citations |
|---|