EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H11N3O2S |
| Net Charge | 0 |
| Average Mass | 201.251 |
| Monoisotopic Mass | 201.05720 |
| SMILES | Cn1cnc(S)c1C[C@H](N)C(=O)O |
| InChI | InChI=1S/C7H11N3O2S/c1-10-3-9-6(13)5(10)2-4(8)7(11)12/h3-4,13H,2,8H2,1H3,(H,11,12)/t4-/m0/s1 |
| InChIKey | XWKKYVJREGXHFO-BYPYZUCNSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Crithidia fasciculata (ncbitaxon:5656) | - | PubMed (11420105) | |
| Leishmania (ncbitaxon:5658) | - | PubMed (11420105) | |
| Trypanosoma brucei (ncbitaxon:5691) | - | PubMed (11420105) | |
| Trypanosoma cruzi (ncbitaxon:5693) | - | PubMed (11420105) |
| Roles Classification |
|---|
| Chemical Roles: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ovothiol A (CHEBI:83318) has role antioxidant (CHEBI:22586) |
| ovothiol A (CHEBI:83318) has role marine metabolite (CHEBI:76507) |
| ovothiol A (CHEBI:83318) has role radical scavenger (CHEBI:48578) |
| ovothiol A (CHEBI:83318) is a L-histidine derivative (CHEBI:84076) |
| ovothiol A (CHEBI:83318) is a aryl thiol (CHEBI:82711) |
| ovothiol A (CHEBI:83318) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| ovothiol A (CHEBI:83318) is tautomer of ovothiol A zwitterion (CHEBI:82723) |
| Incoming Relation(s) |
| ovothiol A zwitterion (CHEBI:82723) is tautomer of ovothiol A (CHEBI:83318) |
| IUPAC Name |
|---|
| 3-methyl-5-sulfanyl-L-histidine |
| Synonyms | Source |
|---|---|
| 1-N-Methyl-4-mercaptohistidine | ChemIDplus |
| 5-mercapto-3-methylhistidine | ChEBI |
| 5-mercapto-3-methyl-L-histidine | ChEBI |
| L-Ovothiol A | KNApSAcK |
| Manual Xrefs | Databases |
|---|---|
| C00028779 | KNApSAcK |
| Ovothiol_A | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4684953 | Reaxys |
| CAS:108418-13-9 | ChemIDplus |
| Citations |
|---|