EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H15N3O2 |
| Net Charge | 0 |
| Average Mass | 197.238 |
| Monoisotopic Mass | 197.11643 |
| SMILES | C[N+](C)(C)[C@@H](Cc1cncn1)C(=O)[O-] |
| InChI | InChI=1S/C9H15N3O2/c1-12(2,3)8(9(13)14)4-7-5-10-6-11-7/h5-6,8H,4H2,1-3H3,(H-,10,11,13,14)/t8-/m0/s1 |
| InChIKey | GPPYTCRVKHULJH-QMMMGPOBSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nα,Nα,Nα-trimethyl-L-histidine (CHEBI:15781) is a Nα-methyl-L-histidines (CHEBI:21911) |
| Nα,Nα,Nα-trimethyl-L-histidine (CHEBI:15781) is a amino-acid betaine (CHEBI:22860) |
| Nα,Nα,Nα-trimethyl-L-histidine (CHEBI:15781) is conjugate base of Nα,Nα,Nα-trimethyl-L-histidinium(1+) (CHEBI:67049) |
| Incoming Relation(s) |
| Nα-(L-γ-glutamyl)-hercynyl-L-cysteine sulfoxide(1−) (CHEBI:82703) has functional parent Nα,Nα,Nα-trimethyl-L-histidine (CHEBI:15781) |
| Nα-(L-γ-glutamyl)-hercynyl-L-selenocysteine(1−) (CHEBI:82704) has functional parent Nα,Nα,Nα-trimethyl-L-histidine (CHEBI:15781) |
| Nα,Nα,Nα-trimethyl-L-histidinium(1+) (CHEBI:67049) is conjugate acid of Nα,Nα,Nα-trimethyl-L-histidine (CHEBI:15781) |
| IUPAC Name |
|---|
| (2S)-3-(1H-imidazol-4-yl)-2-(trimethylammonio)propanoate |
| Synonyms | Source |
|---|---|
| Hercynine | KEGG COMPOUND |
| Nalpha,Nalpha,Nalpha-Trimethyl-L-histidine | KEGG COMPOUND |
| (S)-alpha-Carboxy-N,N,N-trimethyl-1H-imidazole-4-ethanaminium hydroxide, inner salt | ChemIDplus |
| UniProt Name | Source |
|---|---|
| hercynine | UniProt |