EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H17N7 |
| Net Charge | +2 |
| Average Mass | 283.339 |
| Monoisotopic Mass | 283.15345 |
| SMILES | NC(=[NH2+])c1ccc(N=NNc2ccc(C(N)=[NH2+])cc2)cc1 |
| InChI | InChI=1S/C14H15N7/c15-13(16)9-1-5-11(6-2-9)19-21-20-12-7-3-10(4-8-12)14(17)18/h1-8H,(H3,15,16)(H3,17,18)(H,19,20)/p+2 |
| InChIKey | XNYZHCFCZNMTFY-UHFFFAOYSA-P |
| Roles Classification |
|---|
| Biological Role: | trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| Applications: | trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. antiparasitic agent A substance used to treat or prevent parasitic infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diminazene(2+) (CHEBI:82614) has role antiparasitic agent (CHEBI:35442) |
| diminazene(2+) (CHEBI:82614) has role trypanocidal drug (CHEBI:36335) |
| diminazene(2+) (CHEBI:82614) is a carboxamidinium ion (CHEBI:77718) |
| diminazene(2+) (CHEBI:82614) is conjugate acid of diminazene (CHEBI:81724) |
| Incoming Relation(s) |
| diminazene diaceturate (CHEBI:82615) has part diminazene(2+) (CHEBI:82614) |
| diminazene (CHEBI:81724) is conjugate base of diminazene(2+) (CHEBI:82614) |
| IUPAC Name |
|---|
| (triaz-1-ene-1,3-diyldi-4,1-phenylene)bis(iminomethanaminium) |
| Citations |
|---|