EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H15N7.2C4H7NO3 |
| Net Charge | 0 |
| Average Mass | 515.531 |
| Monoisotopic Mass | 515.22408 |
| SMILES | CC(=O)NCC(=O)O.CC(=O)NCC(=O)O.N=C(N)c1ccc(N=NNc2ccc(C(=N)N)cc2)cc1 |
| InChI | InChI=1S/C14H15N7.2C4H7NO3/c15-13(16)9-1-5-11(6-2-9)19-21-20-12-7-3-10(4-8-12)14(17)18;2*1-3(6)5-2-4(7)8/h1-8H,(H3,15,16)(H3,17,18)(H,19,20);2*2H2,1H3,(H,5,6)(H,7,8) |
| InChIKey | OKQSSSVVBOUMNZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| Applications: | antiparasitic agent A substance used to treat or prevent parasitic infections. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diminazene diaceturate (CHEBI:82615) has part diminazene(2+) (CHEBI:82614) |
| diminazene diaceturate (CHEBI:82615) has role antiparasitic agent (CHEBI:35442) |
| diminazene diaceturate (CHEBI:82615) has role trypanocidal drug (CHEBI:36335) |
| diminazene diaceturate (CHEBI:82615) is a N-acetylglycinate salt (CHEBI:82616) |
| Synonyms | Source |
|---|---|
| 1,3-bis(4-guanylphenyl)triazene diaceturate | ChemIDplus |
| 1,3-bis(p-amidinophenyl)triazene bis(N-acetylglycinate) | ChemIDplus |
| 4,4'-diamidinodiazoaminobenzene diaceturate | ChemIDplus |
| 4,4'-(diazoamino)dibenzamidine diaceturate | ChemIDplus |
| di-(4-amidinophenyl)-triazine-(N-1,3)-diaceturate | ChemIDplus |
| diminazene aceturate | ChemIDplus |
| Brand Names | Source |
|---|---|
| Berenil | ChemIDplus |
| Beronal | ChemIDplus |
| Bevenil | ChemIDplus |
| Ganasag | ChemIDplus |
| Ganaseg | ChemIDplus |
| Citations |
|---|