EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:81724 - diminazene
| Formula | C14H15N7 |
| Net Charge | 0 |
| Average Mass | 281.323 |
| Monoisotopic Mass | 281.13889 |
| SMILES | N=C(N)c1ccc(N=NNc2ccc(C(=N)N)cc2)cc1 |
| InChI | InChI=1S/C14H15N7/c15-13(16)9-1-5-11(6-2-9)19-21-20-12-7-3-10(4-8-12)14(17)18/h1-8H,(H3,15,16)(H3,17,18)(H,19,20) |
| InChIKey | XNYZHCFCZNMTFY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| Applications: | trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. antiparasitic agent A substance used to treat or prevent parasitic infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diminazene (CHEBI:81724) has role antiparasitic agent (CHEBI:35442) |
| diminazene (CHEBI:81724) has role trypanocidal drug (CHEBI:36335) |
| diminazene (CHEBI:81724) is a carboxamidine (CHEBI:35359) |
| diminazene (CHEBI:81724) is a triazene derivative (CHEBI:72573) |
| diminazene (CHEBI:81724) is conjugate base of diminazene(2+) (CHEBI:82614) |
| Incoming Relation(s) |
| diminazene(2+) (CHEBI:82614) is conjugate acid of diminazene (CHEBI:81724) |
| IUPAC Name |
|---|
| 4,4'-triaz-1-ene-1,3-diyldibenzenecarboximidamide |
| INNs | Source |
|---|---|
| diminazene | ChemIDplus |
| diminazenum | ChemIDplus |
| diminazène | WHO MedNet |
| diminazeno | ChemIDplus |
| Synonym | Source |
|---|---|
| 4,4'-(1-triazene-1,3-diyl)bis-benzenecarboximidamide | ChemIDplus |
| Citations |
|---|