EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18NO3S2 |
| Net Charge | -1 |
| Average Mass | 324.447 |
| Monoisotopic Mass | 324.07336 |
| SMILES | C[C@H](CS)C(=O)N1C[C@@H](Sc2ccccc2)C[C@H]1C(=O)[O-] |
| InChI | InChI=1S/C15H19NO3S2/c1-10(9-20)14(17)16-8-12(7-13(16)15(18)19)21-11-5-3-2-4-6-11/h2-6,10,12-13,20H,7-9H2,1H3,(H,18,19)/p-1/t10-,12+,13+/m1/s1 |
| InChIKey | UQWLOWFDKAFKAP-WXHSDQCUSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zofenoprilat(1−) (CHEBI:82604) is a monocarboxylic acid anion (CHEBI:35757) |
| zofenoprilat(1−) (CHEBI:82604) is conjugate base of zofenoprilat (CHEBI:82602) |
| Incoming Relation(s) |
| zofenoprilat arginine (CHEBI:82603) has part zofenoprilat(1−) (CHEBI:82604) |
| zofenoprilat (CHEBI:82602) is conjugate acid of zofenoprilat(1−) (CHEBI:82604) |
| IUPAC Name |
|---|
| (2S,4S)-1-[(2S)-2-methyl-3-sulfanylpropanoyl]-4-(phenylsulfanyl)pyrrolidine-2-carboxylate |
| Synonym | Source |
|---|---|
| zofenoprilat anion | ChEBI |