EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H19NO3S2 |
| Net Charge | 0 |
| Average Mass | 325.455 |
| Monoisotopic Mass | 325.08064 |
| SMILES | C[C@H](CS)C(=O)N1C[C@@H](Sc2ccccc2)C[C@H]1C(=O)O |
| InChI | InChI=1S/C15H19NO3S2/c1-10(9-20)14(17)16-8-12(7-13(16)15(18)19)21-11-5-3-2-4-6-11/h2-6,10,12-13,20H,7-9H2,1H3,(H,18,19)/t10-,12+,13+/m1/s1 |
| InChIKey | UQWLOWFDKAFKAP-WXHSDQCUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). anticonvulsant A drug used to prevent seizures or reduce their severity. cardioprotective agent Any protective agent that is able to prevent damage to the heart. vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zofenoprilat (CHEBI:82602) has role anticonvulsant (CHEBI:35623) |
| zofenoprilat (CHEBI:82602) has role apoptosis inhibitor (CHEBI:68494) |
| zofenoprilat (CHEBI:82602) has role cardioprotective agent (CHEBI:77307) |
| zofenoprilat (CHEBI:82602) has role drug metabolite (CHEBI:49103) |
| zofenoprilat (CHEBI:82602) has role EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor (CHEBI:35457) |
| zofenoprilat (CHEBI:82602) has role vasodilator agent (CHEBI:35620) |
| zofenoprilat (CHEBI:82602) is a N-acyl-L-amino acid (CHEBI:21644) |
| zofenoprilat (CHEBI:82602) is a L-proline derivative (CHEBI:84186) |
| zofenoprilat (CHEBI:82602) is a aryl sulfide (CHEBI:35683) |
| zofenoprilat (CHEBI:82602) is a thiol (CHEBI:29256) |
| zofenoprilat (CHEBI:82602) is conjugate acid of zofenoprilat(1−) (CHEBI:82604) |
| Incoming Relation(s) |
| zofenoprilat(1−) (CHEBI:82604) is conjugate base of zofenoprilat (CHEBI:82602) |
| IUPAC Name |
|---|
| (4S)-1-[(2S)-2-methyl-3-sulfanylpropanoyl]-4-(phenylsulfanyl)-L-proline |
| INNs | Source |
|---|---|
| zofenoprilat | WHO MedNet |
| zofenoprilat | ChemIDplus |
| zofénoprilate | WHO MedNet |
| zofenoprilatum | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Zofenoprilat | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6486825 | Reaxys |
| CAS:75176-37-3 | ChemIDplus |
| Citations |
|---|