EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H19NO3S2.C6H14N4O2 |
| Net Charge | 0 |
| Average Mass | 499.659 |
| Monoisotopic Mass | 499.19231 |
| SMILES | C[C@H](CS)C(=O)N1C[C@@H](Sc2ccccc2)C[C@H]1C(=O)O.N=C(N)NCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C15H19NO3S2.C6H14N4O2/c1-10(9-20)14(17)16-8-12(7-13(16)15(18)19)21-11-5-3-2-4-6-11;7-4(5(11)12)2-1-3-10-6(8)9/h2-6,10,12-13,20H,7-9H2,1H3,(H,18,19);4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t10-,12+,13+;4-/m10/s1 |
| InChIKey | OSKWTWSFSUAPKP-KQUFBQNASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| Applications: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). vasodilator agent A drug used to cause dilation of the blood vessels. anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zofenoprilat arginine (CHEBI:82603) has part L-argininium(1+) (CHEBI:32682) |
| zofenoprilat arginine (CHEBI:82603) has part zofenoprilat(1−) (CHEBI:82604) |
| zofenoprilat arginine (CHEBI:82603) has role anticonvulsant (CHEBI:35623) |
| zofenoprilat arginine (CHEBI:82603) has role apoptosis inhibitor (CHEBI:68494) |
| zofenoprilat arginine (CHEBI:82603) has role cardioprotective agent (CHEBI:77307) |
| zofenoprilat arginine (CHEBI:82603) has role EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor (CHEBI:35457) |
| zofenoprilat arginine (CHEBI:82603) has role vasodilator agent (CHEBI:35620) |
| zofenoprilat arginine (CHEBI:82603) is a organoammonium salt (CHEBI:46850) |
| IUPAC Names |
|---|
| (4S)-1-[(2S)-2-methyl-3-sulfanylpropanoyl]-4-(phenylsulfanyl)-L-proline—L-arginine (1/1) |
| (2S)-2-azaniumyl-5-{[ammonio(imino)methyl]amino}pentanoate (2S,4S)-1-[(2S)-2-methyl-3-sulfanylpropanoyl]-4-(phenylsulfanyl)pyrrolidine-2-carboxylate |
| Synonym | Source |
|---|---|
| SQ 26703 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D03776 | KEGG DRUG |
| Zofenoprilat | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6468634 | Reaxys |
| CAS:81872-09-5 | ChemIDplus |