EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16O6 |
| Net Charge | 0 |
| Average Mass | 292.287 |
| Monoisotopic Mass | 292.09469 |
| SMILES | [H][C@@]12C[C@@]3(O)[C@H]4C(=O)O[C@H]([C@H]4C(=C)C)[C@@]4([H])OC(=O)[C@]1(O2)[C@@]34C |
| InChI | InChI=1S/C15H16O6/c1-5(2)7-8-11(16)19-9(7)10-13(3)14(8,18)4-6-15(13,21-6)12(17)20-10/h6-10,18H,1,4H2,2-3H3/t6-,7+,8-,9-,10-,13-,14-,15+/m1/s1 |
| InChIKey | PIMZUZSSNYHVCU-YKWPQBAZSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. GABA antagonist A compound that inhibits the action of γ-aminobutyric acid. |
| Applications: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. GABA antagonist A compound that inhibits the action of γ-aminobutyric acid. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| picrotoxinin (CHEBI:8206) has role GABA antagonist (CHEBI:65259) |
| picrotoxinin (CHEBI:8206) has role plant metabolite (CHEBI:76924) |
| picrotoxinin (CHEBI:8206) has role serotonergic antagonist (CHEBI:48279) |
| picrotoxinin (CHEBI:8206) is a epoxide (CHEBI:32955) |
| picrotoxinin (CHEBI:8206) is a organic heteropentacyclic compound (CHEBI:38164) |
| picrotoxinin (CHEBI:8206) is a picrotoxane sesquiterpenoid (CHEBI:134174) |
| picrotoxinin (CHEBI:8206) is a tertiary alcohol (CHEBI:26878) |
| picrotoxinin (CHEBI:8206) is a γ-lactone (CHEBI:37581) |
| Incoming Relation(s) |
| picrotin (CHEBI:8205) has functional parent picrotoxinin (CHEBI:8206) |
| picrotoxin (CHEBI:134126) has part picrotoxinin (CHEBI:8206) |
| IUPAC Name |
|---|
| (1R,3R,5S,8S,9R,12S,13R,14R)-1-hydroxy-13-methyl-14-(prop-1-en-2-yl)-4,7,10-trioxapentacyclo[6.4.1.19,12.03,5.05,13]tetradecane-6,11-dione |
| Synonyms | Source |
|---|---|
| (−)-picrotoxinin | LIPID MAPS |
| picrotoxinine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00003350 | KNApSAcK |
| C09529 | KEGG COMPOUND |
| LMPR0103540001 | LIPID MAPS |
| RI5 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:42745 | Reaxys |
| CAS:17617-45-7 | KEGG COMPOUND |
| Citations |
|---|