EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16O6 |
| Net Charge | 0 |
| Average Mass | 292.287 |
| Monoisotopic Mass | 292.09469 |
| SMILES | [H][C@@]12C[C@@]3(O)[C@H]4C(=O)O[C@H]([C@H]4C(=C)C)[C@@]4([H])OC(=O)[C@]1(O2)[C@@]34C |
| InChI | InChI=1S/C15H16O6/c1-5(2)7-8-11(16)19-9(7)10-13(3)14(8,18)4-6-15(13,21-6)12(17)20-10/h6-10,18H,1,4H2,2-3H3/t6-,7+,8-,9-,10-,13-,14-,15+/m1/s1 |
| InChIKey | PIMZUZSSNYHVCU-YKWPQBAZSA-N |
| Roles Classification |
|---|
| Biological Roles: | GABA antagonist A compound that inhibits the action of γ-aminobutyric acid. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | GABA antagonist A compound that inhibits the action of γ-aminobutyric acid. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| picrotoxinin (CHEBI:8206) has role GABA antagonist (CHEBI:65259) |
| picrotoxinin (CHEBI:8206) has role plant metabolite (CHEBI:76924) |
| picrotoxinin (CHEBI:8206) has role serotonergic antagonist (CHEBI:48279) |
| picrotoxinin (CHEBI:8206) is a epoxide (CHEBI:32955) |
| picrotoxinin (CHEBI:8206) is a organic heteropentacyclic compound (CHEBI:38164) |
| picrotoxinin (CHEBI:8206) is a picrotoxane sesquiterpenoid (CHEBI:134174) |
| picrotoxinin (CHEBI:8206) is a tertiary alcohol (CHEBI:26878) |
| picrotoxinin (CHEBI:8206) is a γ-lactone (CHEBI:37581) |
| Incoming Relation(s) |
| picrotin (CHEBI:8205) has functional parent picrotoxinin (CHEBI:8206) |
| picrotoxin (CHEBI:134126) has part picrotoxinin (CHEBI:8206) |
| IUPAC Name |
|---|
| (1R,3R,5S,8S,9R,12S,13R,14R)-1-hydroxy-13-methyl-14-(prop-1-en-2-yl)-4,7,10-trioxapentacyclo[6.4.1.19,12.03,5.05,13]tetradecane-6,11-dione |
| Synonyms | Source |
|---|---|
| (−)-picrotoxinin | LIPID MAPS |
| picrotoxinine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00003350 | KNApSAcK |
| C09529 | KEGG COMPOUND |
| LMPR0103540001 | LIPID MAPS |
| RI5 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:42745 | Reaxys |
| CAS:17617-45-7 | KEGG COMPOUND |
| Citations |
|---|