EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18O7 |
| Net Charge | 0 |
| Average Mass | 310.302 |
| Monoisotopic Mass | 310.10525 |
| SMILES | [H][C@@]12C[C@@]3(O)[C@H]4C(=O)O[C@H]([C@H]4C(C)(C)O)[C@@]4([H])OC(=O)[C@]1(O2)[C@@]34C |
| InChI | InChI=1S/C15H18O7/c1-12(2,18)6-7-10(16)20-8(6)9-13(3)14(7,19)4-5-15(13,22-5)11(17)21-9/h5-9,18-19H,4H2,1-3H3/t5-,6+,7-,8-,9-,13-,14-,15+/m1/s1 |
| InChIKey | RYEFFICCPKWYML-QCGISDTRSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| picrotin (CHEBI:8205) has functional parent picrotoxinin (CHEBI:8206) |
| picrotin (CHEBI:8205) has role plant metabolite (CHEBI:76924) |
| picrotin (CHEBI:8205) is a diol (CHEBI:23824) |
| picrotin (CHEBI:8205) is a epoxide (CHEBI:32955) |
| picrotin (CHEBI:8205) is a organic heteropentacyclic compound (CHEBI:38164) |
| picrotin (CHEBI:8205) is a picrotoxane sesquiterpenoid (CHEBI:134174) |
| picrotin (CHEBI:8205) is a tertiary alcohol (CHEBI:26878) |
| picrotin (CHEBI:8205) is a γ-lactone (CHEBI:37581) |
| Incoming Relation(s) |
| picrotoxin (CHEBI:134126) has part picrotin (CHEBI:8205) |
| IUPAC Name |
|---|
| (1R,3R,5S,8S,9R,12S,13R,14S)-1-hydroxy-14-(2-hydroxypropan-2-yl)-13-methyl-4,7,10-trioxapentacyclo[6.4.1.19,12.03,5.05,13]tetradecane-6,11-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1438953 | Reaxys |
| CAS:21416-53-5 | ChemIDplus |
| CAS:21416-53-5 | KEGG COMPOUND |
| Citations |
|---|