EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19F3N6O6S |
| Net Charge | 0 |
| Average Mass | 492.436 |
| Monoisotopic Mass | 492.10389 |
| SMILES | COC(=O)c1cccc(C)c1S(=O)(=O)NC(=O)Nc1nc(OCC(F)(F)F)nc(N(C)C)n1 |
| InChI | InChI=1S/C17H19F3N6O6S/c1-9-6-5-7-10(12(27)31-4)11(9)33(29,30)25-15(28)22-13-21-14(26(2)3)24-16(23-13)32-8-17(18,19)20/h5-7H,8H2,1-4H3,(H2,21,22,23,24,25,28) |
| InChIKey | IMEVJVISCHQJRM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.2.1.6 (acetolactate synthase) inhibitor An EC 2.2.1.* (transketolase/transaldolase) inhibitor that interferes with the action of acetolactate synthase (EC 2.2.1.6). |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. proherbicide A compound that, on administration, must undergo chemical conversion by biochemical (enzymatic), chemical (possibly following an enzymatic step), or physical (e.g. photochemical) activation processes before becoming the pharmacologically active herbicide for which it is a proherbicide. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triflusulfuron-methyl (CHEBI:82047) has functional parent triflusulfuron (CHEBI:142847) |
| triflusulfuron-methyl (CHEBI:82047) has role agrochemical (CHEBI:33286) |
| triflusulfuron-methyl (CHEBI:82047) has role EC 2.2.1.6 (acetolactate synthase) inhibitor (CHEBI:22180) |
| triflusulfuron-methyl (CHEBI:82047) has role proherbicide (CHEBI:136646) |
| triflusulfuron-methyl (CHEBI:82047) is a N-sulfonylurea (CHEBI:76983) |
| triflusulfuron-methyl (CHEBI:82047) is a 1,3,5-triazines (CHEBI:26588) |
| triflusulfuron-methyl (CHEBI:82047) is a aromatic ether (CHEBI:35618) |
| triflusulfuron-methyl (CHEBI:82047) is a benzoate ester (CHEBI:36054) |
| triflusulfuron-methyl (CHEBI:82047) is a methyl ester (CHEBI:25248) |
| triflusulfuron-methyl (CHEBI:82047) is a organofluorine compound (CHEBI:37143) |
| triflusulfuron-methyl (CHEBI:82047) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Names |
|---|
| methyl 2-({[4-(dimethylamino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]carbamoyl}sulfamoyl)-3-methylbenzoate |
| methyl 2-[4-dimethylamino-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-ylcarbamoylsulfamoyl]-m-toluate |
| Synonym | Source |
|---|---|
| methyl 2-[[[[[4-(dimethylamino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]carbonyl]amino]sulfonyl]-3-methylbenzoate | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| 126535-15-7 | Alan Wood's Pesticides |
| 668 | PPDB |
| C18901 | KEGG COMPOUND |
| derivatives/triflusulfuron-methyl | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| CAS:126535-15-7 | ChemIDplus |
| CAS:126535-15-7 | KEGG COMPOUND |
| Citations |
|---|