EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17F3N6O6S |
| Net Charge | 0 |
| Average Mass | 478.409 |
| Monoisotopic Mass | 478.08824 |
| SMILES | Cc1cccc(C(=O)O)c1S(=O)(=O)NC(=O)Nc1nc(OCC(F)(F)F)nc(N(C)C)n1 |
| InChI | InChI=1S/C16H17F3N6O6S/c1-8-5-4-6-9(11(26)27)10(8)32(29,30)24-14(28)21-12-20-13(25(2)3)23-15(22-12)31-7-16(17,18)19/h4-6H,7H2,1-3H3,(H,26,27)(H2,20,21,22,23,24,28) |
| InChIKey | AKTQJCBOGPBERP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 2.2.1.6 (acetolactate synthase) inhibitor An EC 2.2.1.* (transketolase/transaldolase) inhibitor that interferes with the action of acetolactate synthase (EC 2.2.1.6). |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triflusulfuron (CHEBI:142847) has role agrochemical (CHEBI:33286) |
| triflusulfuron (CHEBI:142847) has role EC 2.2.1.6 (acetolactate synthase) inhibitor (CHEBI:22180) |
| triflusulfuron (CHEBI:142847) has role herbicide (CHEBI:24527) |
| triflusulfuron (CHEBI:142847) is a N-sulfonylurea (CHEBI:76983) |
| triflusulfuron (CHEBI:142847) is a 1,3,5-triazines (CHEBI:26588) |
| triflusulfuron (CHEBI:142847) is a aromatic ether (CHEBI:35618) |
| triflusulfuron (CHEBI:142847) is a benzoic acids (CHEBI:22723) |
| triflusulfuron (CHEBI:142847) is a organofluorine compound (CHEBI:37143) |
| triflusulfuron (CHEBI:142847) is a tertiary amino compound (CHEBI:50996) |
| Incoming Relation(s) |
| triflusulfuron-methyl (CHEBI:82047) has functional parent triflusulfuron (CHEBI:142847) |
| IUPAC Name |
|---|
| 2-({[4-(dimethylamino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]carbamoyl}sulfamoyl)-3-methylbenzoic acid |
| Synonyms | Source |
|---|---|
| 2-[[[[[4-(dimethylamino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]carbonyl]amino]sulfonyl]-3-methylbenzoic acid | Alan Wood's Pesticides |
| 2-[4-dimethylamino-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-ylcarbamoylsulfamoyl]-m-toluic acid | Alan Wood's Pesticides |
| 2-(N-{[4-(dimethylamino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]carbamoyl}sulfamoyl)-3-methylbenzoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 1557 | PPDB |
| triflusulfuron | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| CAS:135990-29-3 | ChemIDplus |
| CAS:135990-29-3 | Alan Wood's Pesticides |
| Citations |
|---|