EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18Cl2N2O |
| Net Charge | 0 |
| Average Mass | 313.228 |
| Monoisotopic Mass | 312.07962 |
| SMILES | C[C@@H](NC(=O)C(C#N)C(C)(C)C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H18Cl2N2O/c1-9(11-6-5-10(16)7-13(11)17)19-14(20)12(8-18)15(2,3)4/h5-7,9,12H,1-4H3,(H,19,20)/t9-,12?/m1/s1 |
| InChIKey | YEJGPFZQLRMXOI-PKEIRNPWSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | melanin synthesis inhibitor A depigmentation agent which inhibits the synthesis of melanin. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diclocymet (CHEBI:81799) has part (1R,2R)-diclocymet (CHEBI:84015) |
| diclocymet (CHEBI:81799) has part (1R,2S)-diclocymet (CHEBI:84014) |
| diclocymet (CHEBI:81799) has role antifungal agrochemical (CHEBI:86328) |
| diclocymet (CHEBI:81799) has role insecticide (CHEBI:24852) |
| diclocymet (CHEBI:81799) has role melanin synthesis inhibitor (CHEBI:64933) |
| diclocymet (CHEBI:81799) has role xenobiotic (CHEBI:35703) |
| diclocymet (CHEBI:81799) is a amide fungicide (CHEBI:60600) |
| diclocymet (CHEBI:81799) is a diastereoisomeric mixture (CHEBI:60915) |
| IUPAC Name |
|---|
| 2-cyano-N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-3,3-dimethylbutanamide |
| Manual Xrefs | Databases |
|---|---|
| C18518 | KEGG COMPOUND |
| diclocymet | Alan Wood's Pesticides |
| 2559 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8422721 | Reaxys |
| CAS:139920-32-4 | KEGG COMPOUND |
| CAS:139920-32-4 | ChemIDplus |