EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18Cl2N2O |
| Net Charge | 0 |
| Average Mass | 313.228 |
| Monoisotopic Mass | 312.07962 |
| SMILES | C[C@@H](NC(=O)[C@H](C#N)C(C)(C)C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H18Cl2N2O/c1-9(11-6-5-10(16)7-13(11)17)19-14(20)12(8-18)15(2,3)4/h5-7,9,12H,1-4H3,(H,19,20)/t9-,12+/m1/s1 |
| InChIKey | YEJGPFZQLRMXOI-SKDRFNHKSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1R,2S)-diclocymet (CHEBI:84014) is a 2-cyano-N-[1-(2,4-dichlorophenyl)ethyl]-3,3-dimethylbutanamide (CHEBI:84013) |
| (1R,2S)-diclocymet (CHEBI:84014) is enantiomer of (1R,2R)-diclocymet (CHEBI:84015) |
| Incoming Relation(s) |
| diclocymet (CHEBI:81799) has part (1R,2S)-diclocymet (CHEBI:84014) |
| (1R,2R)-diclocymet (CHEBI:84015) is enantiomer of (1R,2S)-diclocymet (CHEBI:84014) |
| IUPAC Name |
|---|
| (2S)-2-cyano-N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-3,3-dimethylbutanamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8422722 | Reaxys |