EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10O5 |
| Net Charge | -2 |
| Average Mass | 186.163 |
| Monoisotopic Mass | 186.05392 |
| SMILES | O=C([O-])CCCCCC(=O)C(=O)[O-] |
| InChI | InChI=1S/C8H12O5/c9-6(8(12)13)4-2-1-3-5-7(10)11/h1-5H2,(H,10,11)(H,12,13)/p-2 |
| InChIKey | HAGOOZVJLSSXGZ-UHFFFAOYSA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Methanothermobacter thermautotrophicus str. Delta H (ncbitaxon:187420) | - | PubMed (2495771) |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-oxosuberate(2−) (CHEBI:177882) has role bacterial metabolite (CHEBI:76969) |
| 2-oxosuberate(2−) (CHEBI:177882) is a oxo dicarboxylic acid dianion (CHEBI:133294) |
| 2-oxosuberate(2−) (CHEBI:177882) is conjugate base of 2-oxosuberic acid (CHEBI:80587) |
| Incoming Relation(s) |
| 2-oxosuberic acid (CHEBI:80587) is conjugate acid of 2-oxosuberate(2−) (CHEBI:177882) |
| IUPAC Name |
|---|
| 2-oxooctanedioate |
| Synonyms | Source |
|---|---|
| 2-oxooctanedioic acid dianion | ChEBI |
| 2-oxosuberate dianion | ChEBI |
| α-ketosuberate | MetaCyc |
| UniProt Name | Source |
|---|---|
| 2-oxosuberate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-337 | MetaCyc |
| Citations |
|---|