EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H26O4 |
| Net Charge | 0 |
| Average Mass | 282.380 |
| Monoisotopic Mass | 282.18311 |
| SMILES | COC(=O)[C@@H]1O[C@@]1(C)CC/C=C(\C)CC[C@H]1OC1(C)C |
| InChI | InChI=1S/C16H26O4/c1-11(8-9-12-15(2,3)19-12)7-6-10-16(4)13(20-16)14(17)18-5/h7,12-13H,6,8-10H2,1-5H3/b11-7+/t12-,13+,16+/m1/s1 |
| InChIKey | PNZGAJXFVAMMGM-ISGOXSRDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Plautia stali (ncbitaxon:106108) | - | PubMed (20969871) |
| Roles Classification |
|---|
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| juvenile hormone III skipped bisepoxide (CHEBI:83643) has functional parent methyl farnesoate (CHEBI:80535) |
| juvenile hormone III skipped bisepoxide (CHEBI:83643) has role animal metabolite (CHEBI:75767) |
| juvenile hormone III skipped bisepoxide (CHEBI:83643) is a epoxide (CHEBI:32955) |
| juvenile hormone III skipped bisepoxide (CHEBI:83643) is a fatty acid methyl ester (CHEBI:4986) |
| juvenile hormone III skipped bisepoxide (CHEBI:83643) is a juvenile hormone (CHEBI:24943) |
| IUPAC Name |
|---|
| methyl (2R,3S)-3-{(3Z)-6-[(2R)-3,3-dimethyloxiran-2-yl]-4-methylhex-3-en-1-yl}-3-methyloxirane-2-carboxylate |
| Synonyms | Source |
|---|---|
| JH III skipped bisepoxide | SUBMITTER |
| JHSB3 | SUBMITTER |
| methyl (2R,3S,10R)-2,3;10,11-bisepoxyfarnesoate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19972300 | Reaxys |
| Citations |
|---|