EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O2 |
| Net Charge | 0 |
| Average Mass | 170.252 |
| Monoisotopic Mass | 170.13068 |
| SMILES | CC(C)=CCCC(C)CC(=O)O |
| InChI | InChI=1S/C10H18O2/c1-8(2)5-4-6-9(3)7-10(11)12/h5,9H,4,6-7H2,1-3H3,(H,11,12) |
| InChIKey | GJWSUKYXUMVMGX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Citrus limon (ncbitaxon:2708) | - | PubMed (2265211) |
| Roles Classification |
|---|
| Chemical Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| citronellic acid (CHEBI:80507) has functional parent citronellal (CHEBI:47856) |
| citronellic acid (CHEBI:80507) has role flavouring agent (CHEBI:35617) |
| citronellic acid (CHEBI:80507) has role plant metabolite (CHEBI:76924) |
| citronellic acid (CHEBI:80507) is a medium-chain fatty acid (CHEBI:59554) |
| citronellic acid (CHEBI:80507) is a monoterpenoid (CHEBI:25409) |
| citronellic acid (CHEBI:80507) is a monounsaturated fatty acid (CHEBI:25413) |
| Incoming Relation(s) |
| (R)-citronellic acid (CHEBI:144576) is a citronellic acid (CHEBI:80507) |
| (S)-citronellic acid (CHEBI:144575) is a citronellic acid (CHEBI:80507) |
| IUPAC Name |
|---|
| 3,7-dimethyloct-6-enoic acid |
| Synonyms | Source |
|---|---|
| 3,7-dimethyl-6-octenoic acid | KEGG COMPOUND |
| citronellic acid | KEGG COMPOUND |
| rhodinic acid | ChEBI |
| rhodinolic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C16462 | KEGG COMPOUND |
| FDB014607 | FooDB |
| HMDB0035837 | HMDB |
| Citations |
|---|