EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:47856 - citronellal
| Formula | C10H18O |
| Net Charge | 0 |
| Average Mass | 154.253 |
| Monoisotopic Mass | 154.13577 |
| SMILES | [H]C(=O)CC(C)CCC=C(C)C |
| InChI | InChI=1S/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h5,8,10H,4,6-7H2,1-3H3 |
| InChIKey | NEHNMFOYXAPHSD-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Citrus hystrix (ncbitaxon:170989) | exocarp (BTO:0000733) | PubMed (20964319) | The hexane extract of dried and ground fruit peels |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| citronellal (CHEBI:47856) has role antifungal agent (CHEBI:35718) |
| citronellal (CHEBI:47856) has role metabolite (CHEBI:25212) |
| citronellal (CHEBI:47856) is a aldehyde (CHEBI:17478) |
| citronellal (CHEBI:47856) is a monoterpenoid (CHEBI:25409) |
| Incoming Relation(s) |
| citronellic acid (CHEBI:80507) has functional parent citronellal (CHEBI:47856) |
| hydroxycitronellal (CHEBI:53459) has functional parent citronellal (CHEBI:47856) |
| (R)-(+)-citronellal (CHEBI:299) is a citronellal (CHEBI:47856) |
| (S)-(−)-citronellal (CHEBI:368) is a citronellal (CHEBI:47856) |
| IUPAC Name |
|---|
| 3,7-dimethyloct-6-enal |
| Synonyms | Source |
|---|---|
| 3,7-dimethyl-6-octenal | ChemIDplus |
| β-citronellal | NIST Chemistry WebBook |
| 3,7-dimethyl-6-octen-1-al | ChemIDplus |
| 2,3-dihydrocitral | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| Citronellal | Wikipedia |
| C17384 | KEGG COMPOUND |
| Citations |
|---|