EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O2 |
| Net Charge | 0 |
| Average Mass | 170.252 |
| Monoisotopic Mass | 170.13068 |
| SMILES | CC(C)=CCC[C@H](C)CC(=O)O |
| InChI | InChI=1S/C10H18O2/c1-8(2)5-4-6-9(3)7-10(11)12/h5,9H,4,6-7H2,1-3H3,(H,11,12)/t9-/m0/s1 |
| InChIKey | GJWSUKYXUMVMGX-VIFPVBQESA-N |
| Roles Classification |
|---|
| Chemical Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-citronellic acid (CHEBI:144575) is a citronellic acid (CHEBI:80507) |
| (S)-citronellic acid (CHEBI:144575) is conjugate acid of (S)-citronellate (CHEBI:143914) |
| (S)-citronellic acid (CHEBI:144575) is enantiomer of (R)-citronellic acid (CHEBI:144576) |
| Incoming Relation(s) |
| (S)-citronellate (CHEBI:143914) is conjugate base of (S)-citronellic acid (CHEBI:144575) |
| (R)-citronellic acid (CHEBI:144576) is enantiomer of (S)-citronellic acid (CHEBI:144575) |
| IUPAC Name |
|---|
| (3S)-3,7-dimethyloct-6-enoic acid |
| Synonyms | Source |
|---|---|
| (3S)-3,7-dimethyl-6-octenoic acid | ChEBI |
| (−)-citronellic acid | ChEBI |
| (S)-(−)-3,7-dimethyl-6-octenoic acid | ChEBI |
| (S)-3,7-dimethyl-6-octenoic acid | KNApSAcK |
| (S)-(−)-citronellic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00010311 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:2111-53-7 | KNApSAcK |
| Citations |
|---|