EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O5 |
| Net Charge | 0 |
| Average Mass | 340.375 |
| Monoisotopic Mass | 340.13107 |
| SMILES | CC(C)=CCc1c(O)cc(O)c(C(=O)/C=C/c2ccc(O)cc2)c1O |
| InChI | InChI=1S/C20H20O5/c1-12(2)3-9-15-17(23)11-18(24)19(20(15)25)16(22)10-6-13-4-7-14(21)8-5-13/h3-8,10-11,21,23-25H,9H2,1-2H3/b10-6+ |
| InChIKey | FUSADYLVRMROPL-UXBLZVDNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Humulus lupulus (ncbitaxon:3486) | - | PubMed (21912858) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| desmethylxanthohumol (CHEBI:80489) has functional parent trans-chalcone (CHEBI:48965) |
| desmethylxanthohumol (CHEBI:80489) has role plant metabolite (CHEBI:76924) |
| desmethylxanthohumol (CHEBI:80489) is a 2-acyl-4-prenylphloroglucinol (CHEBI:134339) |
| desmethylxanthohumol (CHEBI:80489) is a chalcones (CHEBI:23086) |
| desmethylxanthohumol (CHEBI:80489) is conjugate acid of desmethylxanthohumol(1−) (CHEBI:134302) |
| Incoming Relation(s) |
| desmethylxanthohumol(1−) (CHEBI:134302) is conjugate base of desmethylxanthohumol (CHEBI:80489) |
| IUPAC Name |
|---|
| (2E)-3-(4-hydroxyphenyl)-1-[2,4,6-trihydroxy-3-(3-methylbut-2-en-1-yl)phenyl]prop-2-en-1-one |
| UniProt Name | Source |
|---|---|
| desmethylxanthohumol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C16416 | KEGG COMPOUND |
| HMDB0030610 | HMDB |
| C00035575 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6233194 | Reaxys |
| CAS:115063-39-3 | KEGG COMPOUND |
| CAS:115063-39-3 | ChemIDplus |
| Citations |
|---|