EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H19O5 |
| Net Charge | -1 |
| Average Mass | 339.367 |
| Monoisotopic Mass | 339.12380 |
| SMILES | CC(C)=CCc1c(O)cc(O)c(C(=O)/C=C/c2ccc(O)cc2)c1[O-] |
| InChI | InChI=1S/C20H20O5/c1-12(2)3-9-15-17(23)11-18(24)19(20(15)25)16(22)10-6-13-4-7-14(21)8-5-13/h3-8,10-11,21,23-25H,9H2,1-2H3/p-1/b10-6+ |
| InChIKey | FUSADYLVRMROPL-UXBLZVDNSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| desmethylxanthohumol(1−) (CHEBI:134302) is a phenolate anion (CHEBI:50525) |
| desmethylxanthohumol(1−) (CHEBI:134302) is conjugate base of desmethylxanthohumol (CHEBI:80489) |
| Incoming Relation(s) |
| desmethylxanthohumol (CHEBI:80489) is conjugate acid of desmethylxanthohumol(1−) (CHEBI:134302) |
| IUPAC Name |
|---|
| 3,5-dihydroxy-2-[(2E)-3-(4-hydroxyphenyl)prop-2-enoyl]-6-(3-methylbut-2-en-1-yl)phenolate |
| Citations |
|---|