EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H13O4R |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 221.230 |
| Monoisotopic Mass (excl. R groups) | 221.08138 |
| SMILES | *C(=O)c1c(O)cc(O)c(CC=C(C)C)c1O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-acyl-4-prenylphloroglucinol (CHEBI:134339) has functional parent 2-acylphloroglucinol (CHEBI:134316) |
| 2-acyl-4-prenylphloroglucinol (CHEBI:134339) is a aromatic ketone (CHEBI:76224) |
| 2-acyl-4-prenylphloroglucinol (CHEBI:134339) is a benzenetriol (CHEBI:22707) |
| 2-acyl-4-prenylphloroglucinol (CHEBI:134339) is a olefinic compound (CHEBI:78840) |
| 2-acyl-4-prenylphloroglucinol (CHEBI:134339) is conjugate acid of 2-acyl-4-prenylphloroglucinol(1−) (CHEBI:134371) |
| Incoming Relation(s) |
| 2-(2-methylbutanoyl)-4-prenylphloroglucinol (CHEBI:134340) is a 2-acyl-4-prenylphloroglucinol (CHEBI:134339) |
| 2-(3-methylbutanoyl)-4-prenylphloroglucinol (CHEBI:134341) is a 2-acyl-4-prenylphloroglucinol (CHEBI:134339) |
| 2-isobutyryl-4-prenylphloroglucinol (CHEBI:134342) is a 2-acyl-4-prenylphloroglucinol (CHEBI:134339) |
| desmethylxanthohumol (CHEBI:80489) is a 2-acyl-4-prenylphloroglucinol (CHEBI:134339) |
| 2-acyl-4-prenylphloroglucinol(1−) (CHEBI:134371) is conjugate base of 2-acyl-4-prenylphloroglucinol (CHEBI:134339) |
| Synonym | Source |
|---|---|
| 2-acyl-4-prenylphloroglucinols | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-19787 | MetaCyc |
| Citations |
|---|