EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22O10 |
| Net Charge | 0 |
| Average Mass | 446.408 |
| Monoisotopic Mass | 446.12130 |
| SMILES | COc1cc2c(=O)c(-c3ccc(O)cc3)coc2cc1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C22H22O10/c1-29-15-6-12-14(30-9-13(18(12)25)10-2-4-11(24)5-3-10)7-16(15)31-22-21(28)20(27)19(26)17(8-23)32-22/h2-7,9,17,19-24,26-28H,8H2,1H3/t17-,19-,20+,21-,22-/m1/s1 |
| InChIKey | OZBAVEKZGSOMOJ-MIUGBVLSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Centella asiatica (ncbitaxon:48106) | - | MetaboLights (MTBLS175) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glycitin (CHEBI:80373) has role plant metabolite (CHEBI:76924) |
| glycitin (CHEBI:80373) is a 7-hydroxyisoflavones 7-O-β-D-glucoside (CHEBI:140301) |
| glycitin (CHEBI:80373) is a hydroxyisoflavone (CHEBI:38755) |
| glycitin (CHEBI:80373) is a methoxyisoflavone (CHEBI:38756) |
| glycitin (CHEBI:80373) is a monosaccharide derivative (CHEBI:63367) |
| Incoming Relation(s) |
| glycitein 7-(6-O-acetyl-β-D-glucoside) (CHEBI:133348) has functional parent glycitin (CHEBI:80373) |
| glycitein 7-O-β-D-(2'',4'',6''-O-triacetyl)glucopyranoside (CHEBI:85132) has functional parent glycitin (CHEBI:80373) |
| malonylglycitin (CHEBI:80374) has functional parent glycitin (CHEBI:80373) |
| IUPAC Name |
|---|
| 3-(4-hydroxyphenyl)-6-methoxy-4-oxo-4H-chromen-7-yl β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| Glycitein 7-O-glucoside | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00010089 | KNApSAcK |
| C16195 | KEGG COMPOUND |
| HMDB0002219 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4339336 | Reaxys |
| CAS:40246-10-4 | KEGG COMPOUND |
| CAS:40246-10-4 | ChemIDplus |
| Citations |
|---|