EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H24O13 |
| Net Charge | 0 |
| Average Mass | 532.454 |
| Monoisotopic Mass | 532.12169 |
| SMILES | COc1cc2c(=O)c(-c3ccc(O)cc3)coc2cc1O[C@@H]1O[C@H](COC(=O)CC(=O)O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C25H24O13/c1-34-16-6-13-15(35-9-14(21(13)30)11-2-4-12(26)5-3-11)7-17(16)37-25-24(33)23(32)22(31)18(38-25)10-36-20(29)8-19(27)28/h2-7,9,18,22-26,31-33H,8,10H2,1H3,(H,27,28)/t18-,22-,23+,24-,25-/m1/s1 |
| InChIKey | OWMHCYFEIJPHFB-GOZZSVHWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycine max (ncbitaxon:3847) | - | PubMed (25053043) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| malonylglycitin (CHEBI:80374) has functional parent glycitin (CHEBI:80373) |
| malonylglycitin (CHEBI:80374) has role plant metabolite (CHEBI:76924) |
| malonylglycitin (CHEBI:80374) is a glycosyloxyisoflavone (CHEBI:74630) |
| malonylglycitin (CHEBI:80374) is a hydroxyisoflavone (CHEBI:38755) |
| malonylglycitin (CHEBI:80374) is a malonate ester (CHEBI:38083) |
| malonylglycitin (CHEBI:80374) is a methoxyisoflavone (CHEBI:38756) |
| malonylglycitin (CHEBI:80374) is a monosaccharide derivative (CHEBI:63367) |
| IUPAC Name |
|---|
| 3-(4-hydroxyphenyl)-6-methoxy-4-oxo-4H-1-benzopyran-7-yl 6-O-(carboxyacetyl)-β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| 6''-O-malonylglycitin | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C16197 | KEGG COMPOUND |
| HMDB0039323 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4896907 | Reaxys |
| CAS:137705-39-6 | ChemIDplus |
| Citations |
|---|