EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H24O11 |
| Net Charge | 0 |
| Average Mass | 488.445 |
| Monoisotopic Mass | 488.13186 |
| SMILES | COc1cc2c(=O)c(-c3ccc(O)cc3)coc2cc1O[C@@H]1O[C@H](COC(C)=O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C24H24O11/c1-11(25)32-10-19-21(28)22(29)23(30)24(35-19)34-18-8-16-14(7-17(18)31-2)20(27)15(9-33-16)12-3-5-13(26)6-4-12/h3-9,19,21-24,26,28-30H,10H2,1-2H3/t19-,21-,22+,23-,24-/m1/s1 |
| InChIKey | DUBPGEJGGVZKDD-PFKOEMKTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycine max (ncbitaxon:3847) | |||
| seed (BTO:0001226) | MetaboLights (MTBLS117) | ||
| seed (BTO:0001226) | PubMed (25369450) | ||
| seed (BTO:0001226) | MetaboLights (MTBLS118) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glycitein 7-(6-O-acetyl-β-D-glucoside) (CHEBI:133348) has functional parent glycitin (CHEBI:80373) |
| glycitein 7-(6-O-acetyl-β-D-glucoside) (CHEBI:133348) has role plant metabolite (CHEBI:76924) |
| glycitein 7-(6-O-acetyl-β-D-glucoside) (CHEBI:133348) is a O-acyl carbohydrate (CHEBI:52782) |
| glycitein 7-(6-O-acetyl-β-D-glucoside) (CHEBI:133348) is a acetate ester (CHEBI:47622) |
| glycitein 7-(6-O-acetyl-β-D-glucoside) (CHEBI:133348) is a glycosyloxyisoflavone (CHEBI:74630) |
| glycitein 7-(6-O-acetyl-β-D-glucoside) (CHEBI:133348) is a hydroxyisoflavone (CHEBI:38755) |
| glycitein 7-(6-O-acetyl-β-D-glucoside) (CHEBI:133348) is a methoxyisoflavone (CHEBI:38756) |
| glycitein 7-(6-O-acetyl-β-D-glucoside) (CHEBI:133348) is a monosaccharide derivative (CHEBI:63367) |
| glycitein 7-(6-O-acetyl-β-D-glucoside) (CHEBI:133348) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 3-(4-hydroxyphenyl)-6-methoxy-4-oxo-4H-1-benzopyran-7-yl 6-O-acetyl-β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 6''-O-Acetylglycitin | HMDB |
| 7,4'-Dihydroxy-6-methoxyisoflavone 7-O-(6''-acetylglucoside) | KNApSAcK |
| Acetylglycitin | ChemIDplus |
| Glycitein 6''-O-acetylglucoside | ChemIDplus |
| Glycitein 7-(6-O-acetyl-beta-D-glucopyranoside) | ChemIDplus |
| glycitein 7-O-β-D-(6''-O-acetyl)glucopyranoside | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 8403585 | ChemSpider |
| C00019122 | KNApSAcK |
| HMDB0039489 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4341444 | Reaxys |
| CAS:134859-96-4 | ChemIDplus |
| Citations |
|---|