EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11N2O5SR |
| Net Charge | -2 |
| Average Mass (excl. R groups) | 259.259 |
| Monoisotopic Mass (excl. R groups) | 259.03887 |
| SMILES | *C(=O)N[C@H](C(=O)[O-])[C@]1([H])N[C@@H](C(=O)[O-])C(C)(C)S1 |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| penicilloate(2−) (CHEBI:62524) is a penicilloate anion (CHEBI:61221) |
| penicilloate(2−) (CHEBI:62524) is conjugate base of penicilloic acid (CHEBI:7968) |
| Incoming Relation(s) |
| benzylpenicilloate(2−) (CHEBI:63418) is a penicilloate(2−) (CHEBI:62524) |
| penicilloic acid (CHEBI:7968) is conjugate acid of penicilloate(2−) (CHEBI:62524) |