EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11N2O4SR |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 243.260 |
| Monoisotopic Mass (excl. R groups) | 243.04395 |
| SMILES | *C1=NC(=C([H])N[C@@H](C(=O)O)C(C)(C)S)C(=O)O1 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| penicillenic acid (CHEBI:7960) has functional parent D-valine (CHEBI:27477) |
| penicillenic acid (CHEBI:7960) is a 1,3-oxazoles (CHEBI:46812) |
| penicillenic acid (CHEBI:7960) is a monocarboxylic acid (CHEBI:25384) |
| Incoming Relation(s) |
| benzylpenicillenic acid (CHEBI:60209) is a penicillenic acid (CHEBI:7960) |
| Synonyms | Source |
|---|---|
| Penicillenic acid | KEGG COMPOUND |
| penicillenic acids | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C11747 | KEGG COMPOUND |
| Citations |
|---|