EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11NO2 |
| Net Charge | 0 |
| Average Mass | 117.148 |
| Monoisotopic Mass | 117.07898 |
| SMILES | CC(C)[C@@H](N)C(=O)O |
| InChI | InChI=1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8)/t4-/m1/s1 |
| InChIKey | KZSNJWFQEVHDMF-SCSAIBSYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-valine (CHEBI:27477) is a D-α-amino acid (CHEBI:16733) |
| D-valine (CHEBI:27477) is a valine (CHEBI:27266) |
| D-valine (CHEBI:27477) is conjugate acid of D-valinate (CHEBI:32855) |
| D-valine (CHEBI:27477) is conjugate base of D-valinium (CHEBI:32856) |
| D-valine (CHEBI:27477) is enantiomer of L-valine (CHEBI:16414) |
| D-valine (CHEBI:27477) is tautomer of D-valine zwitterion (CHEBI:74338) |
| Incoming Relation(s) |
| (R)-2-hydroxy-3-methylbutyric acid (CHEBI:46415) has functional parent D-valine (CHEBI:27477) |
| D-valine derivative (CHEBI:84130) has functional parent D-valine (CHEBI:27477) |
| D-valine-d8 (CHEBI:229588) has functional parent D-valine (CHEBI:27477) |
| penicillenic acid (CHEBI:7960) has functional parent D-valine (CHEBI:27477) |
| D-valinium (CHEBI:32856) is conjugate acid of D-valine (CHEBI:27477) |
| D-valinate (CHEBI:32855) is conjugate base of D-valine (CHEBI:27477) |
| L-valine (CHEBI:16414) is enantiomer of D-valine (CHEBI:27477) |
| D-valine residue (CHEBI:50328) is substituent group from D-valine (CHEBI:27477) |
| D-valino group (CHEBI:32858) is substituent group from D-valine (CHEBI:27477) |
| D-valyl group (CHEBI:32857) is substituent group from D-valine (CHEBI:27477) |
| D-valine zwitterion (CHEBI:74338) is tautomer of D-valine (CHEBI:27477) |
| IUPAC Name |
|---|
| D-valine |
| Synonyms | Source |
|---|---|
| (2R)-2-amino-3-methylbutanoic acid | IUPAC |
| DVA | PDBeChem |
| D-Valine | KEGG COMPOUND |
| (R)-valine | NIST Chemistry WebBook |
| (R)-2-Amino-3-methylbutyric acid | KEGG COMPOUND |
| D-Valin | ChEBI |
| Citations |
|---|