EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18N2O4S |
| Net Charge | 0 |
| Average Mass | 334.397 |
| Monoisotopic Mass | 334.09873 |
| SMILES | [H]C(N[C@@H](C(=O)O)C(C)(C)S)=C1N=C(Cc2ccccc2)OC1=O |
| InChI | InChI=1S/C16H18N2O4S/c1-16(2,23)13(14(19)20)17-9-11-15(21)22-12(18-11)8-10-6-4-3-5-7-10/h3-7,9,13,17,23H,8H2,1-2H3,(H,19,20)/t13-/m0/s1 |
| InChIKey | WGIWOHWWPXKJMS-ZDUSSCGKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzylpenicillenic acid (CHEBI:60209) has role allergen (CHEBI:50904) |
| benzylpenicillenic acid (CHEBI:60209) is a penicillenic acid (CHEBI:7960) |
| benzylpenicillenic acid (CHEBI:60209) is conjugate acid of benzylpenicillenate (CHEBI:60541) |
| Incoming Relation(s) |
| PNCMB (CHEBI:60168) is a benzylpenicillenic acid (CHEBI:60209) |
| benzylpenicillenate (CHEBI:60541) is conjugate base of benzylpenicillenic acid (CHEBI:60209) |
| IUPAC Name |
|---|
| N-[(2-benzyl-5-oxo-1,3-oxazol-4(5H)-ylidene)methyl]-3-sulfanyl-D-valine |
| Registry Numbers | Sources |
|---|---|
| Reaxys:42406 | Reaxys |
| CAS:3264-88-8 | ChemIDplus |
| Citations |
|---|