EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22FNO3 |
| Net Charge | 0 |
| Average Mass | 343.398 |
| Monoisotopic Mass | 343.15837 |
| SMILES | [H][C@@]1(c2ccc(F)cc2)CCN(C)C[C@H]1COc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H22FNO3/c1-22-9-8-18(14-2-4-16(21)5-3-14)15(11-22)12-23-17-6-7-19-20(10-17)25-13-24-19/h2-7,10,15,18H,8-9,11-13H2,1H3/t15-,18-/m0/s1 |
| InChIKey | MOJZPKOBKCXNKG-YJBOKZPZSA-N |
| Roles Classification |
|---|
| Chemical Roles: | impurity A chemical role played by any unwanted chemical substance inside a confined amount of liquid, gas, or solid, which differs from the chemical composition of the material or compound. For example, an impurity can be an undesired by-product of a chemical reaction or manufacturing process, a drug contaminant, or can be created upon degradation during storage. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. |
| Application: | serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-methylparoxetine (CHEBI:94536) has functional parent paroxetine (CHEBI:7936) |
| N-methylparoxetine (CHEBI:94536) has role apoptosis inducer (CHEBI:68495) |
| N-methylparoxetine (CHEBI:94536) has role impurity (CHEBI:143130) |
| N-methylparoxetine (CHEBI:94536) has role serotonin uptake inhibitor (CHEBI:50949) |
| N-methylparoxetine (CHEBI:94536) is a aromatic ether (CHEBI:35618) |
| N-methylparoxetine (CHEBI:94536) is a benzodioxoles (CHEBI:38298) |
| N-methylparoxetine (CHEBI:94536) is a monofluorobenzenes (CHEBI:83575) |
| N-methylparoxetine (CHEBI:94536) is a piperidines (CHEBI:26151) |
| N-methylparoxetine (CHEBI:94536) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| (3S,4R)-3-[(1,3-benzodioxol-5-yloxy)methyl]-4-(4-fluorophenyl)-1-methylpiperidine |
| Synonyms | Source |
|---|---|
| (3S,4R)-N-methylparoxetine | ChEBI |
| (3S-trans)-3-[(1,3-benzodioxol-5-yloxy)methyl]-4-(4-fluorophenyl)-1-methylpiperidine | ChEBI |
| trans-(−)-N-methylparoxetine | ChEBI |
| paroxetine related compound F | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-5362 | LINCS |
| SK10992003 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7468178 | Reaxys |
| CAS:110429-36-2 | ChemIDplus |
| Citations |
|---|