EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H34O7 |
| Net Charge | 0 |
| Average Mass | 362.463 |
| Monoisotopic Mass | 362.23045 |
| SMILES | C[C@@H]1O[C@@H](OCCCCCCCCC[C@@H](O)CC(=O)O)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C18H34O7/c1-13-15(20)12-16(21)18(25-13)24-10-8-6-4-2-3-5-7-9-14(19)11-17(22)23/h13-16,18-21H,2-12H2,1H3,(H,22,23)/t13-,14+,15+,16+,18+/m0/s1 |
| InChIKey | SOTOQKINJMPSIE-CWIFOLKKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in dhs-28(hj8) and maoc-1(hj13) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bhos#20 (CHEBI:79260) has functional parent (3R)-3,12-dihydroxylauric acid (CHEBI:79278) |
| bhos#20 (CHEBI:79260) has functional parent oscr#20 (CHEBI:79142) |
| bhos#20 (CHEBI:79260) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| bhos#20 (CHEBI:79260) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| bhos#20 (CHEBI:79260) is a monocarboxylic acid (CHEBI:25384) |
| bhos#20 (CHEBI:79260) is a ω-hydroxy fatty acid ascaroside (CHEBI:79204) |
| bhos#20 (CHEBI:79260) is conjugate acid of bhos#20(1-) (CHEBI:139793) |
| Incoming Relation(s) |
| ibho#20 (CHEBI:79373) has functional parent bhos#20 (CHEBI:79260) |
| bhos#20(1-) (CHEBI:139793) is conjugate base of bhos#20 (CHEBI:79260) |
| IUPAC Name |
|---|
| (3R)-12-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]-3-hydroxydodecanoic acid |
| Synonyms | Source |
|---|---|
| (3R)-12-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]-3-hydroxylauric acid | ChEBI |
| 3R-hydroxy-12-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-dodecanoic acid | SMID |
| 3R-hydroxy-12-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-lauric acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| bhos%2320%0D | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233423 | Reaxys |
| CAS:1355682-77-7 | SMID |
| Citations |
|---|