EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H39NO8 |
| Net Charge | 0 |
| Average Mass | 505.608 |
| Monoisotopic Mass | 505.26757 |
| SMILES | C[C@@H]1O[C@@H](OCCCCCCCCC[C@@H](O)CC(=O)O)[C@H](O)C[C@H]1OC(=O)c1cnc2ccccc12 |
| InChI | InChI=1S/C27H39NO8/c1-18-24(36-26(33)21-17-28-22-13-9-8-12-20(21)22)16-23(30)27(35-18)34-14-10-6-4-2-3-5-7-11-19(29)15-25(31)32/h8-9,12-13,17-19,23-24,27-30H,2-7,10-11,14-16H2,1H3,(H,31,32)/t18-,19+,23+,24+,27+/m0/s1 |
| InChIKey | PQBBEOSMILPNLI-NKVODUSASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in dhs-28(hj8) and maoc-1(hj13) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ibho#20 (CHEBI:79373) has functional parent (3R)-3,12-dihydroxylauric acid (CHEBI:79278) |
| ibho#20 (CHEBI:79373) has functional parent bhos#20 (CHEBI:79260) |
| ibho#20 (CHEBI:79373) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| ibho#20 (CHEBI:79373) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| ibho#20 (CHEBI:79373) is a 4-O-(1H-indol-3-ylcarbonyl)ascaroside (CHEBI:79024) |
| ibho#20 (CHEBI:79373) is a monocarboxylic acid (CHEBI:25384) |
| ibho#20 (CHEBI:79373) is a ω-hydroxy fatty acid ascaroside (CHEBI:79204) |
| IUPAC Name |
|---|
| (3R)-12-{[3,6-dideoxy-4-O-(1H-indol-3-ylcarbonyl)-α-L-arabino-hexopyranosyl]oxy}-3-hydroxydodecanoic acid |
| Synonyms | Source |
|---|---|
| (3R)-12-{[3,6-dideoxy-4-O-(1H-indol-3-ylcarbonyl)-α-L-arabino-hexopyranosyl]oxy}-3-hydroxylauric acid | ChEBI |
| 3R-hydroxy-12-(3'R-hydroxy-5'R-O-(1H-indol-3-ylcarbonyl)-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-dodecanoic acid | SMID |
| 3R-hydroxy-12-(3'R-hydroxy-5'R-O-(1H-indol-3-ylcarbonyl)-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-lauric acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| ibho%2320%0D | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233517 | Reaxys |
| CAS:1355683-43-0 | SMID |
| Citations |
|---|