EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H34O6 |
| Net Charge | 0 |
| Average Mass | 346.464 |
| Monoisotopic Mass | 346.23554 |
| SMILES | C[C@@H]1O[C@@H](OCCCCCCCCCCCC(=O)O)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C18H34O6/c1-14-15(19)13-16(20)18(24-14)23-12-10-8-6-4-2-3-5-7-9-11-17(21)22/h14-16,18-20H,2-13H2,1H3,(H,21,22)/t14-,15+,16+,18+/m0/s1 |
| InChIKey | HTPFVTWQRWJPNG-BVIKNXMNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in acox-1(ok2257), maoc-1(hj13), daf-22(ok693), and dhs-28(hj8) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oscr#20 (CHEBI:79142) has functional parent 12-hydroxylauric acid (CHEBI:39567) |
| oscr#20 (CHEBI:79142) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| oscr#20 (CHEBI:79142) is a monocarboxylic acid (CHEBI:25384) |
| oscr#20 (CHEBI:79142) is a ω-hydroxy fatty acid ascaroside (CHEBI:79204) |
| oscr#20 (CHEBI:79142) is conjugate acid of oscr#20(1−) (CHEBI:139995) |
| Incoming Relation(s) |
| bhos#20 (CHEBI:79260) has functional parent oscr#20 (CHEBI:79142) |
| oscr#20-CoA (CHEBI:139996) has functional parent oscr#20 (CHEBI:79142) |
| oscr#20(1−) (CHEBI:139995) is conjugate base of oscr#20 (CHEBI:79142) |
| IUPAC Name |
|---|
| 12-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]dodecanoic acid |
| Synonyms | Source |
|---|---|
| 12-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]lauric acid | ChEBI |
| 12-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-dodecanoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| oscr%2320 | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233416 | Reaxys |
| CAS:1355682-13-1 | SMID |
| Citations |
|---|