EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H40O4 |
| Net Charge | 0 |
| Average Mass | 344.536 |
| Monoisotopic Mass | 344.29266 |
| SMILES | C[C@@H](O)CCCCCCCCCCCCCCC[C@@H](O)CC(=O)O |
| InChI | InChI=1S/C20H40O4/c1-18(21)15-13-11-9-7-5-3-2-4-6-8-10-12-14-16-19(22)17-20(23)24/h18-19,21-22H,2-17H2,1H3,(H,23,24)/t18-,19-/m1/s1 |
| InChIKey | XZJRFDXTOSIZMX-RTBURBONSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3R,19R)-19-dihydroxyicosanoic acid (CHEBI:79252) has functional parent (19R)-19-hydroxyicosanoic acid (CHEBI:79015) |
| (3R,19R)-19-dihydroxyicosanoic acid (CHEBI:79252) is a (ω−1)-hydroxy fatty acid (CHEBI:78954) |
| (3R,19R)-19-dihydroxyicosanoic acid (CHEBI:79252) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| (3R,19R)-19-dihydroxyicosanoic acid (CHEBI:79252) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| (3R,19R)-19-dihydroxyicosanoic acid (CHEBI:79252) is a long-chain fatty acid (CHEBI:15904) |
| Incoming Relation(s) |
| bhas#36 (CHEBI:79238) has functional parent (3R,19R)-19-dihydroxyicosanoic acid (CHEBI:79252) |
| IUPAC Name |
|---|
| (3R,19R)-19-dihydroxyicosanoic acid |