EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H50O7 |
| Net Charge | 0 |
| Average Mass | 474.679 |
| Monoisotopic Mass | 474.35565 |
| SMILES | C[C@H](CCCCCCCCCCCCCCC[C@@H](O)CC(=O)O)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C26H50O7/c1-20(32-26-24(29)19-23(28)21(2)33-26)16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-22(27)18-25(30)31/h20-24,26-29H,3-19H2,1-2H3,(H,30,31)/t20-,21+,22-,23-,24-,26-/m1/s1 |
| InChIKey | SJIIOKVLMUJXBB-VFRMFGFGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | A major ascaroside in daf-22(ok693) mutant worms, also detected in dhs-28(hj8) and maoc-1(hj13) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bhas#36 (CHEBI:79238) has functional parent (3R,19R)-19-dihydroxyicosanoic acid (CHEBI:79252) |
| bhas#36 (CHEBI:79238) has functional parent ascr#36 (CHEBI:78974) |
| bhas#36 (CHEBI:79238) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| bhas#36 (CHEBI:79238) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| bhas#36 (CHEBI:79238) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| bhas#36 (CHEBI:79238) is a monocarboxylic acid (CHEBI:25384) |
| bhas#36 (CHEBI:79238) is conjugate acid of bhas#36(1-) (CHEBI:139762) |
| Incoming Relation(s) |
| bhas#36(1-) (CHEBI:139762) is conjugate base of bhas#36 (CHEBI:79238) |
| IUPAC Name |
|---|
| (3R,19R)-19-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]-3-hydroxyicosanoic acid |
| Synonyms | Source |
|---|---|
| (3R,19R)-19-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]-3-hydroxyeicosanoic acid | ChEBI |
| 3R-hydroxy-19R-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-eicosanoic acid | ChEBI |
| 3R-hydroxy-19R-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-icosanoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| bhas%2336%0D | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233518 | Reaxys |
| CAS:1355682-68-6 | SMID |
| Citations |
|---|