EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H40O3 |
| Net Charge | 0 |
| Average Mass | 328.537 |
| Monoisotopic Mass | 328.29775 |
| SMILES | C[C@@H](O)CCCCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C20H40O3/c1-19(21)17-15-13-11-9-7-5-3-2-4-6-8-10-12-14-16-18-20(22)23/h19,21H,2-18H2,1H3,(H,22,23)/t19-/m1/s1 |
| InChIKey | NRYRXKPIZDFLGD-LJQANCHMSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (19R)-19-hydroxyicosanoic acid (CHEBI:79015) has functional parent icosanoic acid (CHEBI:28822) |
| (19R)-19-hydroxyicosanoic acid (CHEBI:79015) is a (ω−1)-hydroxy fatty acid (CHEBI:78954) |
| (19R)-19-hydroxyicosanoic acid (CHEBI:79015) is a long-chain fatty acid (CHEBI:15904) |
| Incoming Relation(s) |
| (3R,19R)-19-dihydroxyicosanoic acid (CHEBI:79252) has functional parent (19R)-19-hydroxyicosanoic acid (CHEBI:79015) |
| ascr#36 (CHEBI:78974) has functional parent (19R)-19-hydroxyicosanoic acid (CHEBI:79015) |
| Synonyms | Source |
|---|---|
| (19R)-19-hydroxyarachidic acid | ChemIDplus |
| (19R)-19-hydroxyeicosanoic acid | ChemIDplus |
| (19R)-19-hydroxyicosanoic acid | ChEBI |
| (R)-19-hydroxyarachidic acid | ChemIDplus |
| (R)-19-hydroxyicosanoic acid | ChemIDplus |