EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H42O7 |
| Net Charge | 0 |
| Average Mass | 418.571 |
| Monoisotopic Mass | 418.29305 |
| SMILES | C[C@H](CCCCCCCCCCC[C@@H](O)CC(=O)O)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C22H42O7/c1-16(28-22-20(25)15-19(24)17(2)29-22)12-10-8-6-4-3-5-7-9-11-13-18(23)14-21(26)27/h16-20,22-25H,3-15H2,1-2H3,(H,26,27)/t16-,17+,18-,19-,20-,22-/m1/s1 |
| InChIKey | QQIOQZRDFXAPQI-IGKFWFGWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in wild type (N2) and dhs-28(hj8), daf-22(ok693), maoc-1(hj13), and acox-1(ok2257) mutant worms |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bhas#28 (CHEBI:79234) has functional parent (3R,15R)-3,15-dihydroxypalmitic acid (CHEBI:79248) |
| bhas#28 (CHEBI:79234) has functional parent ascr#28 (CHEBI:78966) |
| bhas#28 (CHEBI:79234) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| bhas#28 (CHEBI:79234) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| bhas#28 (CHEBI:79234) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| bhas#28 (CHEBI:79234) is a monocarboxylic acid (CHEBI:25384) |
| bhas#28 (CHEBI:79234) is conjugate acid of bhas#28(1-) (CHEBI:139750) |
| Incoming Relation(s) |
| ibha#28 (CHEBI:79359) has functional parent bhas#28 (CHEBI:79234) |
| bhas#28(1-) (CHEBI:139750) is conjugate base of bhas#28 (CHEBI:79234) |
| IUPAC Name |
|---|
| (3R,15R)-15-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]-3-hydroxyhexadecanoic acid |
| Synonyms | Source |
|---|---|
| (3R,15R)-15-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]-3-hydroxypalmitic acid | ChEBI |
| 3R-hydroxy-15R-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-hexadecanoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| bhas%2328%0D | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233462 | Reaxys |
| CAS:1355682-60-8 | SMID |
| Citations |
|---|