EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H47NO8 |
| Net Charge | 0 |
| Average Mass | 561.716 |
| Monoisotopic Mass | 561.33017 |
| SMILES | C[C@H](CCCCCCCCCCC[C@@H](O)CC(=O)O)O[C@@H]1O[C@@H](C)[C@H](OC(=O)c2cnc3ccccc23)C[C@H]1O |
| InChI | InChI=1S/C31H47NO8/c1-21(14-10-8-6-4-3-5-7-9-11-15-23(33)18-29(35)36)38-31-27(34)19-28(22(2)39-31)40-30(37)25-20-32-26-17-13-12-16-24(25)26/h12-13,16-17,20-23,27-28,31-34H,3-11,14-15,18-19H2,1-2H3,(H,35,36)/t21-,22+,23-,27-,28-,31-/m1/s1 |
| InChIKey | DVKTXYSVNVCEOI-FFDCXVHWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in dhs-28(hj8) and maoc-1(hj13) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ibha#28 (CHEBI:79359) has functional parent (3R,15R)-3,15-dihydroxypalmitic acid (CHEBI:79248) |
| ibha#28 (CHEBI:79359) has functional parent bhas#28 (CHEBI:79234) |
| ibha#28 (CHEBI:79359) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| ibha#28 (CHEBI:79359) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| ibha#28 (CHEBI:79359) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| ibha#28 (CHEBI:79359) is a 4-O-(1H-indol-3-ylcarbonyl)ascaroside (CHEBI:79024) |
| ibha#28 (CHEBI:79359) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| (3R,15R)-15-{[3,6-dideoxy-4-O-(1H-indol-3-ylcarbonyl)-α-L-arabino-hexopyranosyl]oxy}-3-hydroxyhexadecanoic acid |
| Synonyms | Source |
|---|---|
| (3R,15R)-15-{[3,6-dideoxy-4-O-(1H-indol-3-ylcarbonyl)-α-L-arabino-hexopyranosyl]oxy}-3-hydroxypalmitic acid | ChEBI |
| 3R-hydroxy-15R-(3'R-hydroxy-5'R-O-(1H-indol-3-ylcarbonyl)-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-hexadecanoic acid | SMID |
| 3R-hydroxy-15R-(3'R-hydroxy-5'R-O-(1H-indol-3-ylcarbonyl)-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-palmitic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| ibha%2328%0D | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233532 | Reaxys |
| CAS:1355683-34-9 | SMID |
| Citations |
|---|