EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H42O6 |
| Net Charge | 0 |
| Average Mass | 402.572 |
| Monoisotopic Mass | 402.29814 |
| SMILES | C[C@H](CCCCCCCCCCCCCC(=O)O)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C22H42O6/c1-17(27-22-20(24)16-19(23)18(2)28-22)14-12-10-8-6-4-3-5-7-9-11-13-15-21(25)26/h17-20,22-24H,3-16H2,1-2H3,(H,25,26)/t17-,18+,19-,20-,22-/m1/s1 |
| InChIKey | HSLYPVWJYLQYET-AIYVTKCESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in dhs-28(hj8), acox-1(ok2257), and maoc-1(hj13) mutant worms and a major ascaroside in daf-22(ok693) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ascr#28 (CHEBI:78966) has functional parent (15R)-15-hydroxypalmitic acid (CHEBI:78998) |
| ascr#28 (CHEBI:78966) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| ascr#28 (CHEBI:78966) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| ascr#28 (CHEBI:78966) is a monocarboxylic acid (CHEBI:25384) |
| ascr#28 (CHEBI:78966) is conjugate acid of ascr#28(1-) (CHEBI:139671) |
| Incoming Relation(s) |
| bhas#28 (CHEBI:79234) has functional parent ascr#28 (CHEBI:78966) |
| ascr#28(1-) (CHEBI:139671) is conjugate base of ascr#28 (CHEBI:78966) |
| IUPAC Name |
|---|
| (15R)-15-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]hexadecanoic acid |
| Synonym | Source |
|---|---|
| 15R-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-hexadecanoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| ascr%2328%0D | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233451 | Reaxys |
| CAS:1355681-71-8 | SMID |
| Citations |
|---|