EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H37NO8 |
| Net Charge | 0 |
| Average Mass | 491.581 |
| Monoisotopic Mass | 491.25192 |
| SMILES | C[C@H](CCCCCC[C@@H](O)CC(=O)O)O[C@@H]1O[C@@H](C)[C@H](OC(=O)c2cnc3ccccc23)C[C@H]1O |
| InChI | InChI=1S/C26H37NO8/c1-16(9-5-3-4-6-10-18(28)13-24(30)31)33-26-22(29)14-23(17(2)34-26)35-25(32)20-15-27-21-12-8-7-11-19(20)21/h7-8,11-12,15-18,22-23,26-29H,3-6,9-10,13-14H2,1-2H3,(H,30,31)/t16-,17+,18-,22-,23-,26-/m1/s1 |
| InChIKey | QHLYWGFFZVVDPY-CRZRSRDBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in dhs-28(hj8) and maoc-1(hj13) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ibha#18 (CHEBI:79354) has functional parent (3R,10R)-3,10-dihydroxyundecanoic acid (CHEBI:79242) |
| ibha#18 (CHEBI:79354) has functional parent bhas#18 (CHEBI:79229) |
| ibha#18 (CHEBI:79354) has functional parent icas#18 (CHEBI:79105) |
| ibha#18 (CHEBI:79354) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| ibha#18 (CHEBI:79354) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| ibha#18 (CHEBI:79354) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| ibha#18 (CHEBI:79354) is a 4-O-(1H-indol-3-ylcarbonyl)ascaroside (CHEBI:79024) |
| ibha#18 (CHEBI:79354) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| (3R,10R)-10-{[3,6-dideoxy-4-O-(1H-indol-3-ylcarbonyl)-α-L-arabino-hexopyranosyl]oxy}-3-hydroxyundecanoic acid |
| Synonym | Source |
|---|---|
| 3R-hydroxy-10R-(3'R-hydroxy-5'R-O-(1H-indol-3-ylcarbonyl)-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-undecanoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| ibha%2318 | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233506 | Reaxys |
| CAS:1355683-24-7 | SMID |
| Citations |
|---|