EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H35NO8 |
| Net Charge | 0 |
| Average Mass | 477.554 |
| Monoisotopic Mass | 477.23627 |
| SMILES | C[C@H](CCCCC[C@@H](O)CC(=O)O)O[C@@H]1O[C@@H](C)[C@H](OC(=O)c2cnc3ccccc23)C[C@H]1O |
| InChI | InChI=1S/C25H35NO8/c1-15(8-4-3-5-9-17(27)12-23(29)30)32-25-21(28)13-22(16(2)33-25)34-24(31)19-14-26-20-11-7-6-10-18(19)20/h6-7,10-11,14-17,21-22,25-28H,3-5,8-9,12-13H2,1-2H3,(H,29,30)/t15-,16+,17-,21-,22-,25-/m1/s1 |
| InChIKey | KNTSMTUFIKIJQO-JUYTZFGZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in dhs-28(hj8) and maoc-1(hj13) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ibha#16 (CHEBI:79353) has functional parent (3R,9R)-3,9-dihydroxydecanoic acid (CHEBI:79228) |
| ibha#16 (CHEBI:79353) has functional parent bhas#16 (CHEBI:79227) |
| ibha#16 (CHEBI:79353) has functional parent icas#16 (CHEBI:79094) |
| ibha#16 (CHEBI:79353) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| ibha#16 (CHEBI:79353) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| ibha#16 (CHEBI:79353) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| ibha#16 (CHEBI:79353) is a 4-O-(1H-indol-3-ylcarbonyl)ascaroside (CHEBI:79024) |
| ibha#16 (CHEBI:79353) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| (3R,9R)-9-{[3,6-dideoxy-4-O-(1H-indol-3-ylcarbonyl)-α-L-arabino-hexopyranosyl]oxy}-3-hydroxydecanoic acid |
| Synonym | Source |
|---|---|
| 3R-hydroxy-9R-(3'R-hydroxy-5'R-O-(1H-indol-3-ylcarbonyl)-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-decanoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| ibha%2316%0D | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233496 | Reaxys |
| CAS:1355683-39-4 | SMID |
| Citations |
|---|