EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H42O3 |
| Net Charge | 0 |
| Average Mass | 342.564 |
| Monoisotopic Mass | 342.31340 |
| SMILES | O=C(O)CCCCCCCCCCCCCCCCCCCCO |
| InChI | InChI=1S/C21H42O3/c22-20-18-16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-17-19-21(23)24/h22H,1-20H2,(H,23,24) |
| InChIKey | NENJNFMRWQAPAC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 21-hydroxyhenicosanoic acid (CHEBI:79195) has functional parent henicosanoic acid (CHEBI:39248) |
| 21-hydroxyhenicosanoic acid (CHEBI:79195) is a straight-chain saturated fatty acid (CHEBI:39418) |
| 21-hydroxyhenicosanoic acid (CHEBI:79195) is a ω-hydroxy-long-chain fatty acid (CHEBI:140997) |
| 21-hydroxyhenicosanoic acid (CHEBI:79195) is conjugate acid of 21-hydroxyhenicosanoate (CHEBI:140695) |
| Incoming Relation(s) |
| (3R)-3,21-dihydroxyhenicosanoic acid (CHEBI:79294) has functional parent 21-hydroxyhenicosanoic acid (CHEBI:79195) |
| oscr#38 (CHEBI:79160) has functional parent 21-hydroxyhenicosanoic acid (CHEBI:79195) |
| 21-hydroxyhenicosanoate (CHEBI:140695) is conjugate base of 21-hydroxyhenicosanoic acid (CHEBI:79195) |
| IUPAC Name |
|---|
| 21-hydroxyhenicosanoic acid |
| Synonyms | Source |
|---|---|
| ω-hydroxyhenicosanoic acid | ChEBI |
| 21-hydroxyheneicosanoic acid | ChEBI |
| ω-hydroxyheneicosanoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01050076 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1795235 | Reaxys |