EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H52O6 |
| Net Charge | 0 |
| Average Mass | 472.707 |
| Monoisotopic Mass | 472.37639 |
| SMILES | C[C@@H]1O[C@@H](OCCCCCCCCCCCCCCCCCCCCC(=O)O)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C27H52O6/c1-23-24(28)22-25(29)27(33-23)32-21-19-17-15-13-11-9-7-5-3-2-4-6-8-10-12-14-16-18-20-26(30)31/h23-25,27-29H,2-22H2,1H3,(H,30,31)/t23-,24+,25+,27+/m0/s1 |
| InChIKey | QTWKPFXARCNFRK-AMBDWCSGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in maoc-1(hj13), daf-22(ok693), and dhs-28(hj8) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oscr#38 (CHEBI:79160) has functional parent 21-hydroxyhenicosanoic acid (CHEBI:79195) |
| oscr#38 (CHEBI:79160) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| oscr#38 (CHEBI:79160) is a monocarboxylic acid (CHEBI:25384) |
| oscr#38 (CHEBI:79160) is a ω-hydroxy fatty acid ascaroside (CHEBI:79204) |
| oscr#38 (CHEBI:79160) is conjugate acid of oscr#38(1−) (CHEBI:140050) |
| Incoming Relation(s) |
| bhos#38 (CHEBI:79269) has functional parent oscr#38 (CHEBI:79160) |
| oscr#38-CoA (CHEBI:140051) has functional parent oscr#38 (CHEBI:79160) |
| oscr#38(1−) (CHEBI:140050) is conjugate base of oscr#38 (CHEBI:79160) |
| IUPAC Name |
|---|
| 21-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]henicosanoic acid |
| Synonyms | Source |
|---|---|
| 21-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]heneicosanoic acid | ChEBI |
| 21-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-heneicosanoic acid | ChEBI |
| 21-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-henicosanoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| oscr%2338 | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233516 | Reaxys |
| CAS:1355682-47-1 | SMID |
| Citations |
|---|